N-(2,4-dimethylphenyl)-1-[5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylbenzene-1-sulfonyl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-1-[5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylbenzene-1-sulfonyl]piperidine-4-carboxamide
N-(2,4-dimethylphenyl)-1-[5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylbenzene-1-sulfonyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | G948-4419 |
| Compound Name: | N-(2,4-dimethylphenyl)-1-[5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylbenzene-1-sulfonyl]piperidine-4-carboxamide |
| Molecular Weight: | 482.6 |
| Molecular Formula: | C25 H30 N4 O4 S |
| Smiles: | CCc1nc(c2ccc(C)c(c2)S(N2CCC(CC2)C(Nc2ccc(C)cc2C)=O)(=O)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 5.029 |
| logD: | 5.029 |
| logSw: | -4.5385 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.686 |
| InChI Key: | NLMIEZLKEKMMGJ-UHFFFAOYSA-N |