N-[3-(3-chlorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]furan-2-carboxamide
Chemical Structure Depiction of
N-[3-(3-chlorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]furan-2-carboxamide
N-[3-(3-chlorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]furan-2-carboxamide
Compound characteristics
| Compound ID: | G952-0243 |
| Compound Name: | N-[3-(3-chlorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]furan-2-carboxamide |
| Molecular Weight: | 345.76 |
| Molecular Formula: | C14 H8 Cl N5 O2 S |
| Smiles: | c1cc(cc(c1)[Cl])c1nnc2n1nc(NC(c1ccco1)=O)s2 |
| Stereo: | ACHIRAL |
| logP: | 3.2362 |
| logD: | 3.2261 |
| logSw: | -3.7694 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.704 |
| InChI Key: | SMYALDPWXLOARJ-UHFFFAOYSA-N |