N-[3-(4-ethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-2-phenoxybutanamide
Chemical Structure Depiction of
N-[3-(4-ethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-2-phenoxybutanamide
N-[3-(4-ethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-2-phenoxybutanamide
Compound characteristics
| Compound ID: | G952-1876 |
| Compound Name: | N-[3-(4-ethoxyphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-2-phenoxybutanamide |
| Molecular Weight: | 423.49 |
| Molecular Formula: | C21 H21 N5 O3 S |
| Smiles: | CCC(C(Nc1nn2c(c3ccc(cc3)OCC)nnc2s1)=O)Oc1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5125 |
| logD: | 4.5097 |
| logSw: | -4.139 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.921 |
| InChI Key: | JOMRAFUCNRCHLG-KRWDZBQOSA-N |