3-{[(3-chlorophenyl)methyl]sulfanyl}-6-[4-methyl-2-(thiophen-2-yl)-1,3-thiazol-5-yl]pyridazine
Chemical Structure Depiction of
3-{[(3-chlorophenyl)methyl]sulfanyl}-6-[4-methyl-2-(thiophen-2-yl)-1,3-thiazol-5-yl]pyridazine
3-{[(3-chlorophenyl)methyl]sulfanyl}-6-[4-methyl-2-(thiophen-2-yl)-1,3-thiazol-5-yl]pyridazine
Compound characteristics
| Compound ID: | G954-0258 |
| Compound Name: | 3-{[(3-chlorophenyl)methyl]sulfanyl}-6-[4-methyl-2-(thiophen-2-yl)-1,3-thiazol-5-yl]pyridazine |
| Molecular Weight: | 415.98 |
| Molecular Formula: | C19 H14 Cl N3 S3 |
| Smiles: | Cc1c(c2ccc(nn2)SCc2cccc(c2)[Cl])sc(c2cccs2)n1 |
| Stereo: | ACHIRAL |
| logP: | 6.0477 |
| logD: | 6.0477 |
| logSw: | -6.2359 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 32.129 |
| InChI Key: | NZWPAUGRZJNCJI-UHFFFAOYSA-N |