2-(2-{[1-(ethoxycarbonyl)piperidin-4-yl]amino}-2-oxoethyl)-1-ethyl-4-methyl-1H-pyrrole-3-carboxylic acid
Chemical Structure Depiction of
2-(2-{[1-(ethoxycarbonyl)piperidin-4-yl]amino}-2-oxoethyl)-1-ethyl-4-methyl-1H-pyrrole-3-carboxylic acid
2-(2-{[1-(ethoxycarbonyl)piperidin-4-yl]amino}-2-oxoethyl)-1-ethyl-4-methyl-1H-pyrrole-3-carboxylic acid
Compound characteristics
| Compound ID: | G955-0387 |
| Compound Name: | 2-(2-{[1-(ethoxycarbonyl)piperidin-4-yl]amino}-2-oxoethyl)-1-ethyl-4-methyl-1H-pyrrole-3-carboxylic acid |
| Molecular Weight: | 365.43 |
| Molecular Formula: | C18 H27 N3 O5 |
| Smiles: | CCn1cc(C)c(C(O)=O)c1CC(NC1CCN(CC1)C(=O)OCC)=O |
| Stereo: | ACHIRAL |
| logP: | 1.2252 |
| logD: | -0.574 |
| logSw: | -1.6106 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.088 |
| InChI Key: | WXKPZCDFILIVDI-UHFFFAOYSA-N |