5-amino-N-[(4-fluorophenyl)methyl]-1H-indazole-7-carboxamide
Chemical Structure Depiction of
5-amino-N-[(4-fluorophenyl)methyl]-1H-indazole-7-carboxamide
5-amino-N-[(4-fluorophenyl)methyl]-1H-indazole-7-carboxamide
Compound characteristics
| Compound ID: | H024-0025 |
| Compound Name: | 5-amino-N-[(4-fluorophenyl)methyl]-1H-indazole-7-carboxamide |
| Molecular Weight: | 284.29 |
| Molecular Formula: | C15 H13 F N4 O |
| Smiles: | C(c1ccc(cc1)F)NC(c1cc(cc2cn[nH]c12)N)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2743 |
| logD: | 2.2743 |
| logSw: | -3.0777 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 69.634 |
| InChI Key: | PZKZVVPMCGYFGJ-UHFFFAOYSA-N |