6-chloro-9-(3,4-dimethoxyphenyl)-4-propyl-9,10-dihydro-2H,8H-pyrano[2,3-f][1,3]benzoxazin-2-one
Chemical Structure Depiction of
6-chloro-9-(3,4-dimethoxyphenyl)-4-propyl-9,10-dihydro-2H,8H-pyrano[2,3-f][1,3]benzoxazin-2-one
6-chloro-9-(3,4-dimethoxyphenyl)-4-propyl-9,10-dihydro-2H,8H-pyrano[2,3-f][1,3]benzoxazin-2-one
Compound characteristics
| Compound ID: | IB03-6167 |
| Compound Name: | 6-chloro-9-(3,4-dimethoxyphenyl)-4-propyl-9,10-dihydro-2H,8H-pyrano[2,3-f][1,3]benzoxazin-2-one |
| Molecular Weight: | 415.87 |
| Molecular Formula: | C22 H22 Cl N O5 |
| Smiles: | CCCC1=CC(=O)Oc2c1cc(c1c2CN(CO1)c1ccc(c(c1)OC)OC)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.13 |
| logD: | 5.13 |
| logSw: | -6.55 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 86.2 |
| InChI Key: | FYNFMWIEBDWURZ-UHFFFAOYSA-N |