5-(benzyloxy)-N-[(3-fluorophenyl)methyl]-4-oxo-4H-pyran-2-carboxamide
Chemical Structure Depiction of
5-(benzyloxy)-N-[(3-fluorophenyl)methyl]-4-oxo-4H-pyran-2-carboxamide
5-(benzyloxy)-N-[(3-fluorophenyl)methyl]-4-oxo-4H-pyran-2-carboxamide
Compound characteristics
| Compound ID: | IB05-1680 |
| Compound Name: | 5-(benzyloxy)-N-[(3-fluorophenyl)methyl]-4-oxo-4H-pyran-2-carboxamide |
| Molecular Weight: | 353.35 |
| Molecular Formula: | C20 H16 F N O4 |
| Smiles: | C(c1cccc(c1)F)NC(C1=CC(C(=CO1)OCc1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.06 |
| logD: | 3.06 |
| logSw: | -3.69 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 95.86 |
| InChI Key: | ZFSXWIZKEDAXBX-UHFFFAOYSA-N |