1-benzyl-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide
Chemical Structure Depiction of
1-benzyl-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide
1-benzyl-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide
Compound characteristics
| Compound ID: | IB06-8617 |
| Compound Name: | 1-benzyl-N-(3,4,5-trimethoxyphenyl)-1H-indole-3-carboxamide |
| Molecular Weight: | 416.48 |
| Molecular Formula: | C25 H24 N2 O4 |
| Smiles: | COc1cc(cc(c1OC)OC)NC(c1cn(Cc2ccccc2)c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1 |
| logD: | 4.1 |
| logSw: | -4.65 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.3 |
| InChI Key: | TXJWUEUMOBRWDH-UHFFFAOYSA-N |