N-[2-(3,4-dimethoxybenzoyl)-3-methyl-1-benzofuran-6-yl]-2-methylpropanamide
Chemical Structure Depiction of
N-[2-(3,4-dimethoxybenzoyl)-3-methyl-1-benzofuran-6-yl]-2-methylpropanamide
N-[2-(3,4-dimethoxybenzoyl)-3-methyl-1-benzofuran-6-yl]-2-methylpropanamide
Compound characteristics
| Compound ID: | IB06-9133 |
| Compound Name: | N-[2-(3,4-dimethoxybenzoyl)-3-methyl-1-benzofuran-6-yl]-2-methylpropanamide |
| Molecular Weight: | 381.43 |
| Molecular Formula: | C22 H23 N O5 |
| Smiles: | CC(C)C(Nc1ccc2c(C)c(C(c3ccc(c(c3)OC)OC)=O)oc2c1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.52 |
| logD: | 4.52 |
| logSw: | -5.45 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 106.87 |
| InChI Key: | WCYGQEAKUNWVGP-UHFFFAOYSA-N |