6-(butylsulfanyl)-4-(2-chlorophenyl)-5-cyano-2-methyl-N-phenyl-1,4-dihydropyridine-3-carboxamide
Chemical Structure Depiction of
6-(butylsulfanyl)-4-(2-chlorophenyl)-5-cyano-2-methyl-N-phenyl-1,4-dihydropyridine-3-carboxamide
6-(butylsulfanyl)-4-(2-chlorophenyl)-5-cyano-2-methyl-N-phenyl-1,4-dihydropyridine-3-carboxamide
Compound characteristics
| Compound ID: | IB08-0377 |
| Compound Name: | 6-(butylsulfanyl)-4-(2-chlorophenyl)-5-cyano-2-methyl-N-phenyl-1,4-dihydropyridine-3-carboxamide |
| Molecular Weight: | 437.99 |
| Molecular Formula: | C24 H24 Cl N3 O S |
| Smiles: | CCCCSC1=C(C#N)C(C(=C(C)N1)C(Nc1ccccc1)=O)c1ccccc1[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.1 |
| logD: | 5.5 |
| logSw: | -6.38 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 117.68 |
| InChI Key: | UFBUQVPCRVJZAJ-JOCHJYFZSA-N |