2-(4-methoxyphenyl)-3-{3-[4-(2-methylbutan-2-yl)phenoxy]propyl}quinazolin-4(3H)-one
Chemical Structure Depiction of
2-(4-methoxyphenyl)-3-{3-[4-(2-methylbutan-2-yl)phenoxy]propyl}quinazolin-4(3H)-one
2-(4-methoxyphenyl)-3-{3-[4-(2-methylbutan-2-yl)phenoxy]propyl}quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | IB08-7230 |
| Compound Name: | 2-(4-methoxyphenyl)-3-{3-[4-(2-methylbutan-2-yl)phenoxy]propyl}quinazolin-4(3H)-one |
| Molecular Weight: | 456.58 |
| Molecular Formula: | C29 H32 N2 O3 |
| Smiles: | CCC(C)(C)c1ccc(cc1)OCCCN1C(c2ccc(cc2)OC)=Nc2ccccc2C1=O |
| Stereo: | ACHIRAL |
| logP: | 6.52 |
| logD: | 6.52 |
| logSw: | -7.39 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 67 |
| InChI Key: | CXOZMTZEPZEZNM-UHFFFAOYSA-N |