5-(benzyloxy)-N-(2,5-dimethoxyphenyl)-4-oxo-4H-pyran-2-carboxamide
Chemical Structure Depiction of
5-(benzyloxy)-N-(2,5-dimethoxyphenyl)-4-oxo-4H-pyran-2-carboxamide
5-(benzyloxy)-N-(2,5-dimethoxyphenyl)-4-oxo-4H-pyran-2-carboxamide
Compound characteristics
| Compound ID: | IB08-8639 |
| Compound Name: | 5-(benzyloxy)-N-(2,5-dimethoxyphenyl)-4-oxo-4H-pyran-2-carboxamide |
| Molecular Weight: | 381.38 |
| Molecular Formula: | C21 H19 N O6 |
| Smiles: | COc1ccc(c(c1)NC(C1=CC(C(=CO1)OCc1ccccc1)=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.11 |
| logD: | 2.33 |
| logSw: | -3.52 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 111.41 |
| InChI Key: | YINSASRHQQWYAT-UHFFFAOYSA-N |