2-(5-chloro-1H-indol-1-yl)-N-(3,4-dimethoxyphenyl)acetamide
Chemical Structure Depiction of
2-(5-chloro-1H-indol-1-yl)-N-(3,4-dimethoxyphenyl)acetamide
2-(5-chloro-1H-indol-1-yl)-N-(3,4-dimethoxyphenyl)acetamide
Compound characteristics
| Compound ID: | IB09-2445 |
| Compound Name: | 2-(5-chloro-1H-indol-1-yl)-N-(3,4-dimethoxyphenyl)acetamide |
| Molecular Weight: | 344.8 |
| Molecular Formula: | C18 H17 Cl N2 O3 |
| Smiles: | COc1ccc(cc1OC)NC(Cn1ccc2cc(ccc12)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.82 |
| logD: | 3.82 |
| logSw: | -4.84 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.72 |
| InChI Key: | MECNDOXMHODBOW-UHFFFAOYSA-N |