(2-methoxyphenyl){2-[5-(propan-2-yl)-1,2-oxazol-3-yl]pyrrolidin-1-yl}methanone
Chemical Structure Depiction of
(2-methoxyphenyl){2-[5-(propan-2-yl)-1,2-oxazol-3-yl]pyrrolidin-1-yl}methanone
(2-methoxyphenyl){2-[5-(propan-2-yl)-1,2-oxazol-3-yl]pyrrolidin-1-yl}methanone
Compound characteristics
| Compound ID: | J004-1343 |
| Compound Name: | (2-methoxyphenyl){2-[5-(propan-2-yl)-1,2-oxazol-3-yl]pyrrolidin-1-yl}methanone |
| Molecular Weight: | 314.38 |
| Molecular Formula: | C18 H22 N2 O3 |
| Smiles: | CC(C)c1cc(C2CCCN2C(c2ccccc2OC)=O)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1349 |
| logD: | 3.1349 |
| logSw: | -3.4035 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.112 |
| InChI Key: | OAPCLTMTYIIGFQ-HNNXBMFYSA-N |