[3-(2-fluorophenyl)-1,2-oxazol-5-yl][2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methanone
Chemical Structure Depiction of
[3-(2-fluorophenyl)-1,2-oxazol-5-yl][2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methanone
[3-(2-fluorophenyl)-1,2-oxazol-5-yl][2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methanone
Compound characteristics
| Compound ID: | J004-1388 |
| Compound Name: | [3-(2-fluorophenyl)-1,2-oxazol-5-yl][2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]methanone |
| Molecular Weight: | 369.39 |
| Molecular Formula: | C20 H20 F N3 O3 |
| Smiles: | CCCc1cc(C2CCCN2C(c2cc(c3ccccc3F)no2)=O)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1686 |
| logD: | 4.1686 |
| logSw: | -4.1235 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 59.188 |
| InChI Key: | HGHXIXCLUARPSN-SFHVURJKSA-N |