2-(4-chlorophenyl)-1-[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]ethan-1-one
Chemical Structure Depiction of
2-(4-chlorophenyl)-1-[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]ethan-1-one
2-(4-chlorophenyl)-1-[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | J004-1449 |
| Compound Name: | 2-(4-chlorophenyl)-1-[2-(5-propyl-1,2-oxazol-3-yl)pyrrolidin-1-yl]ethan-1-one |
| Molecular Weight: | 332.83 |
| Molecular Formula: | C18 H21 Cl N2 O2 |
| Smiles: | CCCc1cc(C2CCCN2C(Cc2ccc(cc2)[Cl])=O)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2106 |
| logD: | 4.2106 |
| logSw: | -4.4774 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 37.125 |
| InChI Key: | XNMDHJGTCVIWRR-KRWDZBQOSA-N |