(2-chloro-6-fluorophenyl)[2-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolidin-1-yl]methanone
Chemical Structure Depiction of
(2-chloro-6-fluorophenyl)[2-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolidin-1-yl]methanone
(2-chloro-6-fluorophenyl)[2-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolidin-1-yl]methanone
Compound characteristics
| Compound ID: | J004-1650 |
| Compound Name: | (2-chloro-6-fluorophenyl)[2-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolidin-1-yl]methanone |
| Molecular Weight: | 322.76 |
| Molecular Formula: | C16 H16 Cl F N2 O2 |
| Smiles: | Cc1c(C2CCCN2C(c2c(cccc2[Cl])F)=O)c(C)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.715 |
| logD: | 2.715 |
| logSw: | -3.6719 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.713 |
| InChI Key: | FWKGRVYOAKNLKY-ZDUSSCGKSA-N |