[2-(3-ethyl-1,2-oxazol-5-yl)pyrrolidin-1-yl][3-(trifluoromethyl)phenyl]methanone
Chemical Structure Depiction of
[2-(3-ethyl-1,2-oxazol-5-yl)pyrrolidin-1-yl][3-(trifluoromethyl)phenyl]methanone
[2-(3-ethyl-1,2-oxazol-5-yl)pyrrolidin-1-yl][3-(trifluoromethyl)phenyl]methanone
Compound characteristics
| Compound ID: | J004-1726 |
| Compound Name: | [2-(3-ethyl-1,2-oxazol-5-yl)pyrrolidin-1-yl][3-(trifluoromethyl)phenyl]methanone |
| Molecular Weight: | 338.33 |
| Molecular Formula: | C17 H17 F3 N2 O2 |
| Smiles: | CCc1cc(C2CCCN2C(c2cccc(c2)C(F)(F)F)=O)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5748 |
| logD: | 3.5748 |
| logSw: | -3.6752 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.977 |
| InChI Key: | ZVMAOCCRMFPZAQ-AWEZNQCLSA-N |