(adamantan-1-yl){2-[3-(propan-2-yl)-1,2-oxazol-5-yl]pyrrolidin-1-yl}methanone
Chemical Structure Depiction of
(adamantan-1-yl){2-[3-(propan-2-yl)-1,2-oxazol-5-yl]pyrrolidin-1-yl}methanone
(adamantan-1-yl){2-[3-(propan-2-yl)-1,2-oxazol-5-yl]pyrrolidin-1-yl}methanone
Compound characteristics
| Compound ID: | J004-1785 |
| Compound Name: | (adamantan-1-yl){2-[3-(propan-2-yl)-1,2-oxazol-5-yl]pyrrolidin-1-yl}methanone |
| Molecular Weight: | 342.48 |
| Molecular Formula: | C21 H30 N2 O2 |
| Smiles: | CC(C)c1cc(C2CCCN2C(C23CC4CC(CC(C4)C3)C2)=O)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0052 |
| logD: | 5.0052 |
| logSw: | -4.6099 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.515 |
| InChI Key: | ALJLVSBAOAJNDN-CARYKQCGSA-N |