1-{2-[3-(propan-2-yl)-1,2-oxazol-5-yl]pyrrolidin-1-yl}-2-(thiophen-2-yl)ethan-1-one
Chemical Structure Depiction of
1-{2-[3-(propan-2-yl)-1,2-oxazol-5-yl]pyrrolidin-1-yl}-2-(thiophen-2-yl)ethan-1-one
1-{2-[3-(propan-2-yl)-1,2-oxazol-5-yl]pyrrolidin-1-yl}-2-(thiophen-2-yl)ethan-1-one
Compound characteristics
| Compound ID: | J004-1813 |
| Compound Name: | 1-{2-[3-(propan-2-yl)-1,2-oxazol-5-yl]pyrrolidin-1-yl}-2-(thiophen-2-yl)ethan-1-one |
| Molecular Weight: | 304.41 |
| Molecular Formula: | C16 H20 N2 O2 S |
| Smiles: | CC(C)c1cc(C2CCCN2C(Cc2cccs2)=O)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9763 |
| logD: | 2.9763 |
| logSw: | -3.1365 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.973 |
| InChI Key: | XUYGJZMHNFACOP-AWEZNQCLSA-N |