3-[1-(5-bromothiophene-2-sulfonyl)pyrrolidin-2-yl]-5-propyl-1,2-oxazole
Chemical Structure Depiction of
3-[1-(5-bromothiophene-2-sulfonyl)pyrrolidin-2-yl]-5-propyl-1,2-oxazole
3-[1-(5-bromothiophene-2-sulfonyl)pyrrolidin-2-yl]-5-propyl-1,2-oxazole
Compound characteristics
| Compound ID: | J005-0593 |
| Compound Name: | 3-[1-(5-bromothiophene-2-sulfonyl)pyrrolidin-2-yl]-5-propyl-1,2-oxazole |
| Molecular Weight: | 405.33 |
| Molecular Formula: | C14 H17 Br N2 O3 S2 |
| Smiles: | CCCc1cc(C2CCCN2S(c2ccc(s2)[Br])(=O)=O)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1048 |
| logD: | 4.1048 |
| logSw: | -4.0945 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 54.51 |
| InChI Key: | JSBQBTZXAGMPBB-LBPRGKRZSA-N |