4-[1-(5-bromothiophene-2-sulfonyl)pyrrolidin-2-yl]-3,5-dimethyl-1,2-oxazole
Chemical Structure Depiction of
4-[1-(5-bromothiophene-2-sulfonyl)pyrrolidin-2-yl]-3,5-dimethyl-1,2-oxazole
4-[1-(5-bromothiophene-2-sulfonyl)pyrrolidin-2-yl]-3,5-dimethyl-1,2-oxazole
Compound characteristics
| Compound ID: | J005-0595 |
| Compound Name: | 4-[1-(5-bromothiophene-2-sulfonyl)pyrrolidin-2-yl]-3,5-dimethyl-1,2-oxazole |
| Molecular Weight: | 391.3 |
| Molecular Formula: | C13 H15 Br N2 O3 S2 |
| Smiles: | Cc1c(C2CCCN2S(c2ccc(s2)[Br])(=O)=O)c(C)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9132 |
| logD: | 2.9132 |
| logSw: | -3.2121 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 55.571 |
| InChI Key: | CZEQPYZHYUHIQA-JTQLQIEISA-N |