4-[1-(5-chlorothiophene-2-sulfonyl)pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole
Chemical Structure Depiction of
4-[1-(5-chlorothiophene-2-sulfonyl)pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole
4-[1-(5-chlorothiophene-2-sulfonyl)pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole
Compound characteristics
| Compound ID: | J005-1132 |
| Compound Name: | 4-[1-(5-chlorothiophene-2-sulfonyl)pyrrolidin-2-yl]-5-ethyl-3-methyl-1,2-oxazole |
| Molecular Weight: | 360.88 |
| Molecular Formula: | C14 H17 Cl N2 O3 S2 |
| Smiles: | CCc1c(C2CCCN2S(c2ccc(s2)[Cl])(=O)=O)c(C)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2759 |
| logD: | 3.2759 |
| logSw: | -3.5364 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 55.32 |
| InChI Key: | UVPXAEUIKASCRP-JTQLQIEISA-N |