3,5-dimethyl-4-{1-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidin-2-yl}-1,2-oxazole
Chemical Structure Depiction of
3,5-dimethyl-4-{1-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidin-2-yl}-1,2-oxazole
3,5-dimethyl-4-{1-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidin-2-yl}-1,2-oxazole
Compound characteristics
| Compound ID: | J006-2053 |
| Compound Name: | 3,5-dimethyl-4-{1-[(3,4,5-trimethoxyphenyl)methyl]pyrrolidin-2-yl}-1,2-oxazole |
| Molecular Weight: | 346.43 |
| Molecular Formula: | C19 H26 N2 O4 |
| Smiles: | Cc1c(C2CCCN2Cc2cc(c(c(c2)OC)OC)OC)c(C)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.4227 |
| logD: | -2.0308 |
| logSw: | -2.3364 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.941 |
| InChI Key: | IEIAOTMYNUBTAF-HNNXBMFYSA-N |