3-ethyl-5-(1-{[3-(4-methylphenyl)-1H-pyrazol-4-yl]methyl}pyrrolidin-2-yl)-1,2-oxazole
Chemical Structure Depiction of
3-ethyl-5-(1-{[3-(4-methylphenyl)-1H-pyrazol-4-yl]methyl}pyrrolidin-2-yl)-1,2-oxazole
3-ethyl-5-(1-{[3-(4-methylphenyl)-1H-pyrazol-4-yl]methyl}pyrrolidin-2-yl)-1,2-oxazole
Compound characteristics
| Compound ID: | J006-2594 |
| Compound Name: | 3-ethyl-5-(1-{[3-(4-methylphenyl)-1H-pyrazol-4-yl]methyl}pyrrolidin-2-yl)-1,2-oxazole |
| Molecular Weight: | 336.44 |
| Molecular Formula: | C20 H24 N4 O |
| Smiles: | CCc1cc(C2CCCN2Cc2c[nH]nc2c2ccc(C)cc2)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8325 |
| logD: | 0.1554 |
| logSw: | -3.7897 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.417 |
| InChI Key: | OTJKULHEWCTKJK-SFHVURJKSA-N |