4-{1-[(2,3-dimethoxyphenyl)methyl]pyrrolidin-2-yl}-5-ethyl-3-methyl-1,2-oxazole
Chemical Structure Depiction of
4-{1-[(2,3-dimethoxyphenyl)methyl]pyrrolidin-2-yl}-5-ethyl-3-methyl-1,2-oxazole
4-{1-[(2,3-dimethoxyphenyl)methyl]pyrrolidin-2-yl}-5-ethyl-3-methyl-1,2-oxazole
Compound characteristics
| Compound ID: | J006-2920 |
| Compound Name: | 4-{1-[(2,3-dimethoxyphenyl)methyl]pyrrolidin-2-yl}-5-ethyl-3-methyl-1,2-oxazole |
| Molecular Weight: | 330.43 |
| Molecular Formula: | C19 H26 N2 O3 |
| Smiles: | CCc1c(C2CCCN2Cc2cccc(c2OC)OC)c(C)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2763 |
| logD: | 0.111 |
| logSw: | -3.1537 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 41.06 |
| InChI Key: | ONXZZGDACJRALW-HNNXBMFYSA-N |