4-{1-[(4-chlorophenyl)methyl]pyrrolidin-2-yl}-5-ethyl-3-methyl-1,2-oxazole
Chemical Structure Depiction of
4-{1-[(4-chlorophenyl)methyl]pyrrolidin-2-yl}-5-ethyl-3-methyl-1,2-oxazole
4-{1-[(4-chlorophenyl)methyl]pyrrolidin-2-yl}-5-ethyl-3-methyl-1,2-oxazole
Compound characteristics
| Compound ID: | J006-2953 |
| Compound Name: | 4-{1-[(4-chlorophenyl)methyl]pyrrolidin-2-yl}-5-ethyl-3-methyl-1,2-oxazole |
| Molecular Weight: | 304.82 |
| Molecular Formula: | C17 H21 Cl N2 O |
| Smiles: | CCc1c(C2CCCN2Cc2ccc(cc2)[Cl])c(C)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8657 |
| logD: | 2.6952 |
| logSw: | -4.213 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 25.7121 |
| InChI Key: | WQFILYHPRQVSNA-HNNXBMFYSA-N |