2-(4-chlorophenyl)-N-(2,5-dimethoxyphenyl)azepane-1-carboxamide
Chemical Structure Depiction of
2-(4-chlorophenyl)-N-(2,5-dimethoxyphenyl)azepane-1-carboxamide
2-(4-chlorophenyl)-N-(2,5-dimethoxyphenyl)azepane-1-carboxamide
Compound characteristics
| Compound ID: | J007-0274 |
| Compound Name: | 2-(4-chlorophenyl)-N-(2,5-dimethoxyphenyl)azepane-1-carboxamide |
| Molecular Weight: | 388.89 |
| Molecular Formula: | C21 H25 Cl N2 O3 |
| Smiles: | COc1ccc(c(c1)NC(N1CCCCCC1c1ccc(cc1)[Cl])=O)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1594 |
| logD: | 5.1594 |
| logSw: | -5.8043 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.937 |
| InChI Key: | ZOQQGFFGIXLZEU-IBGZPJMESA-N |