N-(3,5-dimethoxyphenyl)-2-(3-methylphenyl)azepane-1-carboxamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-2-(3-methylphenyl)azepane-1-carboxamide
N-(3,5-dimethoxyphenyl)-2-(3-methylphenyl)azepane-1-carboxamide
Compound characteristics
| Compound ID: | J007-0884 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-2-(3-methylphenyl)azepane-1-carboxamide |
| Molecular Weight: | 368.48 |
| Molecular Formula: | C22 H28 N2 O3 |
| Smiles: | Cc1cccc(c1)C1CCCCCN1C(Nc1cc(cc(c1)OC)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1638 |
| logD: | 5.1638 |
| logSw: | -4.9159 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.549 |
| InChI Key: | LSCKZNUOIIKSPX-NRFANRHFSA-N |