N-(2-methylpropyl)-2-(thiophen-2-yl)azepane-1-carboxamide
Chemical Structure Depiction of
N-(2-methylpropyl)-2-(thiophen-2-yl)azepane-1-carboxamide
N-(2-methylpropyl)-2-(thiophen-2-yl)azepane-1-carboxamide
Compound characteristics
| Compound ID: | J007-1212 |
| Compound Name: | N-(2-methylpropyl)-2-(thiophen-2-yl)azepane-1-carboxamide |
| Molecular Weight: | 280.43 |
| Molecular Formula: | C15 H24 N2 O S |
| Smiles: | CC(C)CNC(N1CCCCCC1c1cccs1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6743 |
| logD: | 3.6743 |
| logSw: | -3.7686 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.073 |
| InChI Key: | MHWZMKALGJDKGE-ZDUSSCGKSA-N |