1-[(4-chlorophenyl)methanesulfonyl]-N-(2-methoxyphenyl)piperidine-3-carboxamide
Chemical Structure Depiction of
1-[(4-chlorophenyl)methanesulfonyl]-N-(2-methoxyphenyl)piperidine-3-carboxamide
1-[(4-chlorophenyl)methanesulfonyl]-N-(2-methoxyphenyl)piperidine-3-carboxamide
Compound characteristics
| Compound ID: | J009-1696 |
| Compound Name: | 1-[(4-chlorophenyl)methanesulfonyl]-N-(2-methoxyphenyl)piperidine-3-carboxamide |
| Molecular Weight: | 422.93 |
| Molecular Formula: | C20 H23 Cl N2 O4 S |
| Smiles: | COc1ccccc1NC(C1CCCN(C1)S(Cc1ccc(cc1)[Cl])(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9273 |
| logD: | 2.9272 |
| logSw: | -3.5441 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.801 |
| InChI Key: | MJKDVDPAQIQPDP-INIZCTEOSA-N |