1-[(4-chlorophenyl)methanesulfonyl]-N-[(2-methylphenyl)methyl]piperidine-3-carboxamide
Chemical Structure Depiction of
1-[(4-chlorophenyl)methanesulfonyl]-N-[(2-methylphenyl)methyl]piperidine-3-carboxamide
1-[(4-chlorophenyl)methanesulfonyl]-N-[(2-methylphenyl)methyl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | J009-1717 |
| Compound Name: | 1-[(4-chlorophenyl)methanesulfonyl]-N-[(2-methylphenyl)methyl]piperidine-3-carboxamide |
| Molecular Weight: | 420.96 |
| Molecular Formula: | C21 H25 Cl N2 O3 S |
| Smiles: | Cc1ccccc1CNC(C1CCCN(C1)S(Cc1ccc(cc1)[Cl])(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4524 |
| logD: | 3.4524 |
| logSw: | -3.8478 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.19 |
| InChI Key: | ZGFUCXXTZFCHNP-IBGZPJMESA-N |