4-(2-chlorophenyl)-1-(4-fluorophenyl)-1,4,5,7-tetrahydro-6H-pyrazolo[3,4-b]pyridin-6-one
Chemical Structure Depiction of
4-(2-chlorophenyl)-1-(4-fluorophenyl)-1,4,5,7-tetrahydro-6H-pyrazolo[3,4-b]pyridin-6-one
4-(2-chlorophenyl)-1-(4-fluorophenyl)-1,4,5,7-tetrahydro-6H-pyrazolo[3,4-b]pyridin-6-one
Compound characteristics
| Compound ID: | J012-2767 |
| Compound Name: | 4-(2-chlorophenyl)-1-(4-fluorophenyl)-1,4,5,7-tetrahydro-6H-pyrazolo[3,4-b]pyridin-6-one |
| Molecular Weight: | 341.77 |
| Molecular Formula: | C18 H13 Cl F N3 O |
| Smiles: | C1C(c2ccccc2[Cl])c2cnn(c3ccc(cc3)F)c2NC1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9176 |
| logD: | 3.9176 |
| logSw: | -4.1956 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.738 |
| InChI Key: | APJZCVJZBPAFHD-CQSZACIVSA-N |