5-[(benzenesulfonyl)(methyl)amino]-N-propyl-1-benzothiophene-2-carboxamide
Chemical Structure Depiction of
5-[(benzenesulfonyl)(methyl)amino]-N-propyl-1-benzothiophene-2-carboxamide
5-[(benzenesulfonyl)(methyl)amino]-N-propyl-1-benzothiophene-2-carboxamide
Compound characteristics
| Compound ID: | J019-0296 |
| Compound Name: | 5-[(benzenesulfonyl)(methyl)amino]-N-propyl-1-benzothiophene-2-carboxamide |
| Molecular Weight: | 388.51 |
| Molecular Formula: | C19 H20 N2 O3 S2 |
| Smiles: | CCCNC(c1cc2cc(ccc2s1)N(C)S(c1ccccc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0735 |
| logD: | 4.0735 |
| logSw: | -4.0235 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.333 |
| InChI Key: | CDKFZYKVUJQKHY-UHFFFAOYSA-N |