methyl 2-{[6-bromo-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoate
Chemical Structure Depiction of
methyl 2-{[6-bromo-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoate
methyl 2-{[6-bromo-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoate
Compound characteristics
| Compound ID: | J022-0734 |
| Compound Name: | methyl 2-{[6-bromo-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoate |
| Molecular Weight: | 441.26 |
| Molecular Formula: | C20 H14 Br F N4 O2 |
| Smiles: | COC(c1ccccc1Nc1c(c2ccc(cc2)F)nc2cnc(cn12)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 4.6653 |
| logD: | 4.6653 |
| logSw: | -4.4317 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.535 |
| InChI Key: | IPQOTLBJCFUDPJ-UHFFFAOYSA-N |