methyl 3-{[6-bromo-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoate
Chemical Structure Depiction of
methyl 3-{[6-bromo-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoate
methyl 3-{[6-bromo-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoate
Compound characteristics
| Compound ID: | J022-0954 |
| Compound Name: | methyl 3-{[6-bromo-2-(4-fluorophenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoate |
| Molecular Weight: | 441.26 |
| Molecular Formula: | C20 H14 Br F N4 O2 |
| Smiles: | COC(c1cccc(c1)Nc1c(c2ccc(cc2)F)nc2cnc(cn12)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 4.8952 |
| logD: | 4.8952 |
| logSw: | -4.6639 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.233 |
| InChI Key: | BIRNQKSZOBHBMA-UHFFFAOYSA-N |