N-(5-chloro-2-methoxyphenyl)-1-phenylcyclopentane-1-carboxamide
Chemical Structure Depiction of
N-(5-chloro-2-methoxyphenyl)-1-phenylcyclopentane-1-carboxamide
N-(5-chloro-2-methoxyphenyl)-1-phenylcyclopentane-1-carboxamide
Compound characteristics
| Compound ID: | J029-0806 |
| Compound Name: | N-(5-chloro-2-methoxyphenyl)-1-phenylcyclopentane-1-carboxamide |
| Molecular Weight: | 329.82 |
| Molecular Formula: | C19 H20 Cl N O2 |
| Smiles: | COc1ccc(cc1NC(C1(CCCC1)c1ccccc1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.6918 |
| logD: | 4.5664 |
| logSw: | -4.8546 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.5488 |
| InChI Key: | FAZURAFMAHLUGE-UHFFFAOYSA-N |