3-(3,4-dimethylphenoxy)-N-ethyl-N,8-dimethyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]oxazepine-2-sulfonamide
Chemical Structure Depiction of
3-(3,4-dimethylphenoxy)-N-ethyl-N,8-dimethyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]oxazepine-2-sulfonamide
3-(3,4-dimethylphenoxy)-N-ethyl-N,8-dimethyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]oxazepine-2-sulfonamide
Compound characteristics
| Compound ID: | J030-1116 |
| Compound Name: | 3-(3,4-dimethylphenoxy)-N-ethyl-N,8-dimethyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]oxazepine-2-sulfonamide |
| Molecular Weight: | 466.56 |
| Molecular Formula: | C25 H26 N2 O5 S |
| Smiles: | CCN(C)S(c1cc2C(Nc3cc(C)ccc3Oc2cc1Oc1ccc(C)c(C)c1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3438 |
| logD: | 5.3289 |
| logSw: | -5.2403 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.735 |
| InChI Key: | KCWJNYPDIPKBAH-UHFFFAOYSA-N |