N-(2-ethoxyphenyl)-2-[(4-hydroxyquinazolin-2-yl)sulfanyl]acetamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-2-[(4-hydroxyquinazolin-2-yl)sulfanyl]acetamide
N-(2-ethoxyphenyl)-2-[(4-hydroxyquinazolin-2-yl)sulfanyl]acetamide
Compound characteristics
| Compound ID: | J033-0123 |
| Compound Name: | N-(2-ethoxyphenyl)-2-[(4-hydroxyquinazolin-2-yl)sulfanyl]acetamide |
| Molecular Weight: | 355.41 |
| Molecular Formula: | C18 H17 N3 O3 S |
| Smiles: | CCOc1ccccc1NC(CSc1nc(c2ccccc2n1)O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.168 |
| logD: | 3.0813 |
| logSw: | -3.2642 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.597 |
| InChI Key: | PZGLPZBXBKWMMA-UHFFFAOYSA-N |