N-{1-[1-(3,4-dimethoxyphenyl)-1H-tetrazol-5-yl]cyclohexyl}aniline
Chemical Structure Depiction of
N-{1-[1-(3,4-dimethoxyphenyl)-1H-tetrazol-5-yl]cyclohexyl}aniline
N-{1-[1-(3,4-dimethoxyphenyl)-1H-tetrazol-5-yl]cyclohexyl}aniline
Compound characteristics
| Compound ID: | J034-0094 |
| Compound Name: | N-{1-[1-(3,4-dimethoxyphenyl)-1H-tetrazol-5-yl]cyclohexyl}aniline |
| Molecular Weight: | 379.46 |
| Molecular Formula: | C21 H25 N5 O2 |
| Smiles: | COc1ccc(cc1OC)n1c(C2(CCCCC2)Nc2ccccc2)nnn1 |
| Stereo: | ACHIRAL |
| logP: | 3.8939 |
| logD: | 3.8939 |
| logSw: | -4.0323 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 64.566 |
| InChI Key: | XPVBPYXPEYGDSG-UHFFFAOYSA-N |