4-{2-[1-(4-methoxyphenyl)-1H-tetrazol-5-yl]butan-2-yl}morpholine
Chemical Structure Depiction of
4-{2-[1-(4-methoxyphenyl)-1H-tetrazol-5-yl]butan-2-yl}morpholine
4-{2-[1-(4-methoxyphenyl)-1H-tetrazol-5-yl]butan-2-yl}morpholine
Compound characteristics
| Compound ID: | J034-0965 |
| Compound Name: | 4-{2-[1-(4-methoxyphenyl)-1H-tetrazol-5-yl]butan-2-yl}morpholine |
| Molecular Weight: | 317.39 |
| Molecular Formula: | C16 H23 N5 O2 |
| Smiles: | CCC(C)(c1nnnn1c1ccc(cc1)OC)N1CCOCC1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.3959 |
| logD: | 2.3959 |
| logSw: | -2.3319 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 58.383 |
| InChI Key: | IYVQUMNNBLAASH-INIZCTEOSA-N |