2-methoxy-N-{1-[1-(4-methoxyphenyl)-1H-tetrazol-5-yl]cyclohexyl}aniline
Chemical Structure Depiction of
2-methoxy-N-{1-[1-(4-methoxyphenyl)-1H-tetrazol-5-yl]cyclohexyl}aniline
2-methoxy-N-{1-[1-(4-methoxyphenyl)-1H-tetrazol-5-yl]cyclohexyl}aniline
Compound characteristics
| Compound ID: | J034-1033 |
| Compound Name: | 2-methoxy-N-{1-[1-(4-methoxyphenyl)-1H-tetrazol-5-yl]cyclohexyl}aniline |
| Molecular Weight: | 379.46 |
| Molecular Formula: | C21 H25 N5 O2 |
| Smiles: | COc1ccc(cc1)n1c(C2(CCCCC2)Nc2ccccc2OC)nnn1 |
| Stereo: | ACHIRAL |
| logP: | 4.4279 |
| logD: | 4.4279 |
| logSw: | -4.3564 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.782 |
| InChI Key: | DLPWTCICXPKLIM-UHFFFAOYSA-N |