N-{2-[1-(2-ethyl-6-methylphenyl)-1H-tetrazol-5-yl]propan-2-yl}-2,4-dimethylaniline
Chemical Structure Depiction of
N-{2-[1-(2-ethyl-6-methylphenyl)-1H-tetrazol-5-yl]propan-2-yl}-2,4-dimethylaniline
N-{2-[1-(2-ethyl-6-methylphenyl)-1H-tetrazol-5-yl]propan-2-yl}-2,4-dimethylaniline
Compound characteristics
| Compound ID: | J034-1265 |
| Compound Name: | N-{2-[1-(2-ethyl-6-methylphenyl)-1H-tetrazol-5-yl]propan-2-yl}-2,4-dimethylaniline |
| Molecular Weight: | 349.48 |
| Molecular Formula: | C21 H27 N5 |
| Smiles: | CCc1cccc(C)c1n1c(C(C)(C)Nc2ccc(C)cc2C)nnn1 |
| Stereo: | ACHIRAL |
| logP: | 5.5049 |
| logD: | 5.5049 |
| logSw: | -5.4476 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.526 |
| InChI Key: | TTYDEXVRCGFGEX-UHFFFAOYSA-N |