2-methoxy-N-(2-{1-[3-(trifluoromethyl)phenyl]-1H-tetrazol-5-yl}butan-2-yl)aniline
Chemical Structure Depiction of
2-methoxy-N-(2-{1-[3-(trifluoromethyl)phenyl]-1H-tetrazol-5-yl}butan-2-yl)aniline
2-methoxy-N-(2-{1-[3-(trifluoromethyl)phenyl]-1H-tetrazol-5-yl}butan-2-yl)aniline
Compound characteristics
| Compound ID: | J034-1448 |
| Compound Name: | 2-methoxy-N-(2-{1-[3-(trifluoromethyl)phenyl]-1H-tetrazol-5-yl}butan-2-yl)aniline |
| Molecular Weight: | 391.39 |
| Molecular Formula: | C19 H20 F3 N5 O |
| Smiles: | CCC(C)(c1nnnn1c1cccc(c1)C(F)(F)F)Nc1ccccc1OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9651 |
| logD: | 4.9651 |
| logSw: | -4.6078 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.226 |
| InChI Key: | IFAZLNGOXRJJKD-SFHVURJKSA-N |