N-methyl-1-[1-(4-methylphenyl)-1H-tetrazol-5-yl]cyclopentan-1-amine
Chemical Structure Depiction of
N-methyl-1-[1-(4-methylphenyl)-1H-tetrazol-5-yl]cyclopentan-1-amine
N-methyl-1-[1-(4-methylphenyl)-1H-tetrazol-5-yl]cyclopentan-1-amine
Compound characteristics
| Compound ID: | J034-1747 |
| Compound Name: | N-methyl-1-[1-(4-methylphenyl)-1H-tetrazol-5-yl]cyclopentan-1-amine |
| Molecular Weight: | 257.34 |
| Molecular Formula: | C14 H19 N5 |
| Smiles: | Cc1ccc(cc1)n1c(C2(CCCC2)NC)nnn1 |
| Stereo: | ACHIRAL |
| logP: | 2.4625 |
| logD: | 2.4495 |
| logSw: | -2.4541 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.416 |
| InChI Key: | KMDWKLGRPZQJRE-UHFFFAOYSA-N |