4-chloro-N-{1-[1-(3-methylphenyl)-1H-tetrazol-5-yl]cyclopentyl}aniline
Chemical Structure Depiction of
4-chloro-N-{1-[1-(3-methylphenyl)-1H-tetrazol-5-yl]cyclopentyl}aniline
4-chloro-N-{1-[1-(3-methylphenyl)-1H-tetrazol-5-yl]cyclopentyl}aniline
Compound characteristics
| Compound ID: | J034-1921 |
| Compound Name: | 4-chloro-N-{1-[1-(3-methylphenyl)-1H-tetrazol-5-yl]cyclopentyl}aniline |
| Molecular Weight: | 353.85 |
| Molecular Formula: | C19 H20 Cl N5 |
| Smiles: | Cc1cccc(c1)n1c(C2(CCCC2)Nc2ccc(cc2)[Cl])nnn1 |
| Stereo: | ACHIRAL |
| logP: | 5.0768 |
| logD: | 5.0768 |
| logSw: | -5.1693 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.671 |
| InChI Key: | TYDJOUBCICZEOW-UHFFFAOYSA-N |