1-[1-(3-methylphenyl)-1H-tetrazol-5-yl]cyclohexan-1-amine
Chemical Structure Depiction of
1-[1-(3-methylphenyl)-1H-tetrazol-5-yl]cyclohexan-1-amine
1-[1-(3-methylphenyl)-1H-tetrazol-5-yl]cyclohexan-1-amine
Compound characteristics
| Compound ID: | J034-1933 |
| Compound Name: | 1-[1-(3-methylphenyl)-1H-tetrazol-5-yl]cyclohexan-1-amine |
| Molecular Weight: | 257.34 |
| Molecular Formula: | C14 H19 N5 |
| Smiles: | Cc1cccc(c1)n1c(C2(CCCCC2)N)nnn1 |
| Stereo: | ACHIRAL |
| logP: | 1.7383 |
| logD: | 1.7352 |
| logSw: | -1.4108 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.839 |
| InChI Key: | MKQNOXSXABBOTJ-UHFFFAOYSA-N |