N-(2,4-dimethylphenyl)-2-{[6-(dimethylsulfamoyl)-4-methylquinolin-2-yl]sulfanyl}propanamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-2-{[6-(dimethylsulfamoyl)-4-methylquinolin-2-yl]sulfanyl}propanamide
N-(2,4-dimethylphenyl)-2-{[6-(dimethylsulfamoyl)-4-methylquinolin-2-yl]sulfanyl}propanamide
Compound characteristics
| Compound ID: | J037-0328 |
| Compound Name: | N-(2,4-dimethylphenyl)-2-{[6-(dimethylsulfamoyl)-4-methylquinolin-2-yl]sulfanyl}propanamide |
| Molecular Weight: | 457.61 |
| Molecular Formula: | C23 H27 N3 O3 S2 |
| Smiles: | CC(C(Nc1ccc(C)cc1C)=O)Sc1cc(C)c2cc(ccc2n1)S(N(C)C)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3161 |
| logD: | 5.3161 |
| logSw: | -5.3351 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.987 |
| InChI Key: | FAYIAOFGEWTQAS-KRWDZBQOSA-N |