rel-(4aR,10bR)-5-(3,4-diethoxyphenyl)-9-ethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline
Chemical Structure Depiction of
rel-(4aR,10bR)-5-(3,4-diethoxyphenyl)-9-ethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline
rel-(4aR,10bR)-5-(3,4-diethoxyphenyl)-9-ethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline
Compound characteristics
| Compound ID: | J038-0758 |
| Compound Name: | rel-(4aR,10bR)-5-(3,4-diethoxyphenyl)-9-ethyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| Molecular Weight: | 381.51 |
| Molecular Formula: | C24 H31 N O3 |
| Smiles: | CCc1ccc2c(c1)[C@@H]1[C@@H](CCCO1)C(c1ccc(c(c1)OCC)OCC)N2 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.8036 |
| logD: | 4.8033 |
| logSw: | -4.5875 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.25 |
| InChI Key: | VSIWDNJEOBRANQ-WOPGWRJJSA-N |